Products 929000-34-0
CAS 929000-34-0 is the registry number for N,N-Diethyl 3-bromo-5-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
3-bromo-N,N-diethyl-5-nitrobenzamide (CAS 929000-34-0) is a chemical compound with the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. IUPAC name: 3-bromo-N,N-diethyl-5-nitrobenzamide. InChIKey: BCJGPZGRXWUAAQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O3 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 3-bromo-N,N-diethyl-5-nitrobenzamide |
| InChIKey | BCJGPZGRXWUAAQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)