CAS 1236119-88-2 appears in our catalog under these names: 4-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%, 4-Methylpyridine-2-boronic acid pinacol ester, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1236119-88-2) is a chemical compound with the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. IUPAC name: 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: LXOMIGCZWSWSQI-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2 |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | LXOMIGCZWSWSQI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=CC(=C2)C |
Computed by PubChem (NCBI)