Products 1236144-52-7

CAS 1236144-52-7 is the registry number for tert-Butyl azetidine-3-carboxylate acetate, 97%. Offered by: AmBeed. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Acetic acid;tert-butyl azetidine-3-carboxylate (CAS 1236144-52-7) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: acetic acid;tert-butyl azetidine-3-carboxylate. InChIKey: ZAYKPGRYPKUMLW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC nameacetic acid;tert-butyl azetidine-3-carboxylate
InChIKeyZAYKPGRYPKUMLW-UHFFFAOYSA-N
SMILESCC(=O)O.CC(C)(C)OC(=O)C1CNC1

Computed by PubChem (NCBI)