CAS 1236228-63-9 appears in our catalog under these names: 1-{2-bromo-5-methyl-(1,2,4)triazolo(3,2-b)(1,3)oxazol-6-yl}ethan-1-one, 95%, 1-{2-Bromo-5-methyl-(1,2,4)triazolo(3,2-b)(1,3)oxazol-6-yl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-bromo-5-methyl-[1,3]oxazolo[3,2-b][1,2,4]triazol-6-yl)ethanone (CAS 1236228-63-9) is a chemical compound with the molecular formula C7H6BrN3O2 and a molecular weight of 244.05 g/mol. IUPAC name: 1-(2-bromo-5-methyl-[1,3]oxazolo[3,2-b][1,2,4]triazol-6-yl)ethanone. InChIKey: NBVFZOXQQHUYEK-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O2 |
|---|---|
| Molecular weight | 244.05 g/mol |
| IUPAC name | 1-(2-bromo-5-methyl-[1,3]oxazolo[3,2-b][1,2,4]triazol-6-yl)ethanone |
| InChIKey | NBVFZOXQQHUYEK-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=NC(=N2)Br)O1)C(=O)C |
Computed by PubChem (NCBI)