CAS 2482719-42-4 is the registry number for 5-Bromo-3-methylpyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-methyl-1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione (CAS 2482719-42-4) is a chemical compound with the molecular formula C7H6BrN3O2 and a molecular weight of 244.05 g/mol. IUPAC name: 5-bromo-3-methyl-1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione. InChIKey: HHIMMVPWUJQRAG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O2 |
|---|---|
| Molecular weight | 244.05 g/mol |
| IUPAC name | 5-bromo-3-methyl-1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione |
| InChIKey | HHIMMVPWUJQRAG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C=CN2NC1=O)Br |
Computed by PubChem (NCBI)