CAS 668992-72-1 appears in our catalog under these names: 4-Bromopyridine-2,6-dicarboxamide, 95%, 4-Bromopyridine-2,6-dicarboxamide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg, 1g.
4-bromopyridine-2,6-dicarboxamide (CAS 668992-72-1) is a chemical compound with the molecular formula C7H6BrN3O2 and a molecular weight of 244.05 g/mol. IUPAC name: 4-bromopyridine-2,6-dicarboxamide. InChIKey: UVQHWUPJBJBKCO-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3O2 |
|---|---|
| Molecular weight | 244.05 g/mol |
| IUPAC name | 4-bromopyridine-2,6-dicarboxamide |
| InChIKey | UVQHWUPJBJBKCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)N)C(=O)N)Br |
Computed by PubChem (NCBI)