CAS 1236284-45-9 appears in our catalog under these names: 3-Fluoro-4-hydroxy-n,n-dimethylbenzamide, 95%, 3-Fluoro-4-hydroxy-N,N-dimethylbenzamide. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
3-fluoro-4-hydroxy-N,N-dimethylbenzamide (CAS 1236284-45-9) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-fluoro-4-hydroxy-N,N-dimethylbenzamide. InChIKey: ATEDSKJUHQPXGU-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-fluoro-4-hydroxy-N,N-dimethylbenzamide |
| InChIKey | ATEDSKJUHQPXGU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)O)F |
Computed by PubChem (NCBI)