Products 123642-61-5
CAS 123642-61-5 is the registry number for (1-(4,5-Dimethoxy-2-nitrophenyl)ethylidene)hydrazine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
(E)-1-(4,5-dimethoxy-2-nitrophenyl)ethylidenehydrazine (CAS 123642-61-5) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: (E)-1-(4,5-dimethoxy-2-nitrophenyl)ethylidenehydrazine. InChIKey: FBDMXPWHQWYTQW-WUXMJOGZSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | (E)-1-(4,5-dimethoxy-2-nitrophenyl)ethylidenehydrazine |
| InChIKey | FBDMXPWHQWYTQW-WUXMJOGZSA-N |
| SMILES | C/C(=N\N)/C1=CC(=C(C=C1[N+](=O)[O-])OC)OC |
Computed by PubChem (NCBI)