Products 123657-16-9
CAS 123657-16-9 is the registry number for 1-tert-Butyl-3-(propan-2-yl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-tert-butyl-3-propan-2-ylpyrazole-4-carboxylic acid (CAS 123657-16-9) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: 1-tert-butyl-3-propan-2-ylpyrazole-4-carboxylic acid. InChIKey: LJFSEIBNJGEORT-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-tert-butyl-3-propan-2-ylpyrazole-4-carboxylic acid |
| InChIKey | LJFSEIBNJGEORT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C=C1C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)