Products 1236764-45-6

CAS 1236764-45-6 is the registry number for 2-((Tetrahydro-2H-pyran-4-yl)oxy)ethyl 4-methylbenzenesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.

Structural formula: {0} (CAS {1})

2-(oxan-4-yloxy)ethyl 4-methylbenzenesulfonate (CAS 1236764-45-6) is a chemical compound with the molecular formula C14H20O5S and a molecular weight of 300.37 g/mol. IUPAC name: 2-(oxan-4-yloxy)ethyl 4-methylbenzenesulfonate. InChIKey: DMGUHLFRBAPODU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O5S
Molecular weight300.37 g/mol
IUPAC name2-(oxan-4-yloxy)ethyl 4-methylbenzenesulfonate
InChIKeyDMGUHLFRBAPODU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOC2CCOCC2

Computed by PubChem (NCBI)