CAS 1236862-00-2 appears in our catalog under these names: 4-(Azetidin-3-yloxy)benzonitrile hydrochloride, 98%, 4-(azetidin-3-yloxy)benzonitrile hcl, 4-(Azetidin-3-yloxy)benzonitrile Hydrochloride, 98%, 98%, 4-(AZETIDIN-3-YLOXY)BENZONITRILE HCL, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-(azetidin-3-yloxy)benzonitrile;hydrochloride (CAS 1236862-00-2) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 4-(azetidin-3-yloxy)benzonitrile;hydrochloride. InChIKey: JMLTYJWMTBIZMK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 4-(azetidin-3-yloxy)benzonitrile;hydrochloride |
| InChIKey | JMLTYJWMTBIZMK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)