Products 1237141-26-2

CAS 1237141-26-2 is the registry number for 2-Chloro-4-(furan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(furan-2-yl)benzoic acid (CAS 1237141-26-2) is a chemical compound with the molecular formula C11H7ClO3 and a molecular weight of 222.62 g/mol. IUPAC name: 2-chloro-4-(furan-2-yl)benzoic acid. InChIKey: ZAZIBKXDHKSTIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClO3
Molecular weight222.62 g/mol
IUPAC name2-chloro-4-(furan-2-yl)benzoic acid
InChIKeyZAZIBKXDHKSTIZ-UHFFFAOYSA-N
SMILESC1=COC(=C1)C2=CC(=C(C=C2)C(=O)O)Cl

Computed by PubChem (NCBI)