CAS 1237141-26-2 is the registry number for 2-Chloro-4-(furan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-chloro-4-(furan-2-yl)benzoic acid (CAS 1237141-26-2) is a chemical compound with the molecular formula C11H7ClO3 and a molecular weight of 222.62 g/mol. IUPAC name: 2-chloro-4-(furan-2-yl)benzoic acid. InChIKey: ZAZIBKXDHKSTIZ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO3 |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-chloro-4-(furan-2-yl)benzoic acid |
| InChIKey | ZAZIBKXDHKSTIZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)