Products 1255636-77-1
CAS 1255636-77-1 appears in our catalog under these names: 2-Chloro-5-(furan-2-yl)benzoic acid 97%, 2-Chloro-5-(furan-2-yl)benzoic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-5-(furan-2-yl)benzoic acid (CAS 1255636-77-1) is a chemical compound with the molecular formula C11H7ClO3 and a molecular weight of 222.62 g/mol. IUPAC name: 2-chloro-5-(furan-2-yl)benzoic acid. InChIKey: RJRGYEPNDTXQFT-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO3 |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-chloro-5-(furan-2-yl)benzoic acid |
| InChIKey | RJRGYEPNDTXQFT-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)