CAS 51627-58-8 appears in our catalog under these names: 3-Benzyl-4-chloro-2,5-dihydrofuran-2,5-dione, 95%, 3-Benzyl-4-chloro-2,5-dihydrofuran-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-benzyl-4-chlorofuran-2,5-dione (CAS 51627-58-8) is a chemical compound with the molecular formula C11H7ClO3 and a molecular weight of 222.62 g/mol. IUPAC name: 3-benzyl-4-chlorofuran-2,5-dione. InChIKey: LMGXQXFLDQBYIW-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO3 |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 3-benzyl-4-chlorofuran-2,5-dione |
| InChIKey | LMGXQXFLDQBYIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C(=O)OC2=O)Cl |
Computed by PubChem (NCBI)