Products 123761-12-6

CAS 123761-12-6 is the registry number for 2-Amino-3-(quinolin-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-quinolin-2-ylpropanoic acid (CAS 123761-12-6) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2-amino-3-quinolin-2-ylpropanoic acid. InChIKey: CRSSRGSNAKKNNI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O2
Molecular weight216.24 g/mol
IUPAC name2-amino-3-quinolin-2-ylpropanoic acid
InChIKeyCRSSRGSNAKKNNI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=N2)CC(C(=O)O)N

Computed by PubChem (NCBI)