CAS 1237884-36-4 is the registry number for 1H-Indole-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Indole-1-sulfonamide (CAS 1237884-36-4) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: indole-1-sulfonamide. InChIKey: DAFLLGDLWPUZES-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | indole-1-sulfonamide |
| InChIKey | DAFLLGDLWPUZES-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2S(=O)(=O)N |
Computed by PubChem (NCBI)