Products 123792-44-9
CAS 123792-44-9 is the registry number for 5-Bromo-2-(2-methylpropane-2-sulfonyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-2-tert-butylsulfonylpyridine (CAS 123792-44-9) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: 5-bromo-2-tert-butylsulfonylpyridine. InChIKey: HQNOLAFNFWKITI-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | 5-bromo-2-tert-butylsulfonylpyridine |
| InChIKey | HQNOLAFNFWKITI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)