CAS 1239019-99-8 is the registry number for (2S,3S)-1-(Diphenylphosphanyl)-3-methylpentan-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-amine (CAS 1239019-99-8) is a chemical compound with the molecular formula C18H24NP and a molecular weight of 285.4 g/mol. IUPAC name: (2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-amine. InChIKey: KBPUDCSECNQALO-MAUKXSAKSA-N.
| Molecular formula | C18H24NP |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-amine |
| InChIKey | KBPUDCSECNQALO-MAUKXSAKSA-N |
| SMILES | CC[C@H](C)[C@@H](CP(C1=CC=CC=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)