CAS 286454-86-2 appears in our catalog under these names: (S)-1-(Diphenylphosphino)-3,3-dimethylbutan-2-amine, 95%, (S)-1-(Diphenylphosphino)-3,3-dimethylbutan-2-amine, 98%, (S)-1-(Diphenylphosphino)-3,3-dimethylbutan-2-amine 95%, (S)-1-(DIPHENYLPHOSPHINO)-3,3-DIMETHYLB&. Offered by: Combi-blocks, AmBeed, Fluorochem, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500MG.
(2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine (CAS 286454-86-2) is a chemical compound with the molecular formula C18H24NP and a molecular weight of 285.4 g/mol. IUPAC name: (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine. InChIKey: SGBNMEAXYLJQRV-QGZVFWFLSA-N.
| Molecular formula | C18H24NP |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine |
| InChIKey | SGBNMEAXYLJQRV-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[C@@H](CP(C1=CC=CC=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)