CAS 1366384-12-4 appears in our catalog under these names: (R)-1-(Diphenylphosphino)-3,3-dimethyl-2-butylamine, 95%, (R)–1–(Diphenylphosphino)–2–amino–3,3–dimethylbutane, (R)-1-(Diphenylphosphino)-3,3-dimethyl-2-butylamine, ≥97%, ≥97%, (R)-1-(Diphenylphosphino)-2-amino-3,3-dimethylbutane, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
(2R)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine (CAS 1366384-12-4) is a chemical compound with the molecular formula C18H24NP and a molecular weight of 285.4 g/mol. IUPAC name: (2R)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine. InChIKey: SGBNMEAXYLJQRV-KRWDZBQOSA-N.
| Molecular formula | C18H24NP |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (2R)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine |
| InChIKey | SGBNMEAXYLJQRV-KRWDZBQOSA-N |
| SMILES | CC(C)(C)[C@H](CP(C1=CC=CC=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)