Products 1239312-56-1

CAS 1239312-56-1 is the registry number for Azelastine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-[(3-methoxy-3-oxopropyl)-methylamino]butanoate (CAS 1239312-56-1) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: methyl 4-[(3-methoxy-3-oxopropyl)-methylamino]butanoate. InChIKey: QRQAQWZCJBPJCO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC namemethyl 4-[(3-methoxy-3-oxopropyl)-methylamino]butanoate
InChIKeyQRQAQWZCJBPJCO-UHFFFAOYSA-N
SMILESCN(CCCC(=O)OC)CCC(=O)OC

Computed by PubChem (NCBI)