CAS 1239753-94-6 is the registry number for 6-(4-Chlorophenyl)[1,2,4]triazolo[4,3-b]pyridazin-3(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(4-chlorophenyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (CAS 1239753-94-6) is a chemical compound with the molecular formula C11H7ClN4O and a molecular weight of 246.65 g/mol. IUPAC name: 6-(4-chlorophenyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one. InChIKey: ZZXRFZZRFRYWSZ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4O |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| InChIKey | ZZXRFZZRFRYWSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN3C(=NNC3=O)C=C2)Cl |
Computed by PubChem (NCBI)