CAS 937604-48-3 is the registry number for 2-Amino-1-(1-aza-2-(5-chloro-2-hydroxyphenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
(Z)-2-amino-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]but-2-enedinitrile (CAS 937604-48-3) is a chemical compound with the molecular formula C11H7ClN4O and a molecular weight of 246.65 g/mol. IUPAC name: (Z)-2-amino-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]but-2-enedinitrile. InChIKey: ONVDVFWQUJLQNL-MGHZFKQTSA-N.
| Molecular formula | C11H7ClN4O |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | (Z)-2-amino-3-[(5-chloro-2-hydroxyphenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | ONVDVFWQUJLQNL-MGHZFKQTSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=N/C(=C(/C#N)\N)/C#N)O |
Computed by PubChem (NCBI)