CAS 650628-64-1 is the registry number for 1-(3-Chlorophenyl)-1H-pyrazolo(3,4-d)pyrimidin-4-ol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(3-chlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 650628-64-1) is a chemical compound with the molecular formula C11H7ClN4O and a molecular weight of 246.65 g/mol. IUPAC name: 1-(3-chlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: MKPBMRRXCXUQGA-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4O |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | MKPBMRRXCXUQGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)