Products 2516881-15-3
CAS 2516881-15-3 is the registry number for Ethyl 5,6-dicyano-1H-benzo[d]imidazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,6-dicyano-1H-benzimidazole-2-carboxylate (CAS 2516881-15-3) is a chemical compound with the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. IUPAC name: ethyl 5,6-dicyano-1H-benzimidazole-2-carboxylate. InChIKey: QSJWSTOEWMHRLX-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | ethyl 5,6-dicyano-1H-benzimidazole-2-carboxylate |
| InChIKey | QSJWSTOEWMHRLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C=C(C(=C2)C#N)C#N |
Computed by PubChem (NCBI)