CAS 1239843-38-9 is the registry number for 6-(3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl)-2,3-dihydropyridazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one (CAS 1239843-38-9) is a chemical compound with the molecular formula C13H10N4O3 and a molecular weight of 270.24 g/mol. IUPAC name: 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one. InChIKey: CJSOITYWNKZDEG-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O3 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one |
| InChIKey | CJSOITYWNKZDEG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)C3=NNC(=O)C=C3 |
Computed by PubChem (NCBI)