CAS 937263-44-0 appears in our catalog under these names: 7-(2-Methyl-4-nitrophenoxy)-[1,2,4]triazolo[1,5-a]pyridine, 98%, 7-(2-Methyl-4-nitrophenoxy)(1,2,4)triazolo(1,5-a)pyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
7-(2-methyl-4-nitrophenoxy)-[1,2,4]triazolo[1,5-a]pyridine (CAS 937263-44-0) is a chemical compound with the molecular formula C13H10N4O3 and a molecular weight of 270.24 g/mol. IUPAC name: 7-(2-methyl-4-nitrophenoxy)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: RYAGSLNGXGMZRV-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O3 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 7-(2-methyl-4-nitrophenoxy)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | RYAGSLNGXGMZRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC2=CC3=NC=NN3C=C2 |
Computed by PubChem (NCBI)