Products 1710661-64-5
CAS 1710661-64-5 is the registry number for Methyl 1-[4-(1,2,4-oxadiazol-3-yl)phenyl]-1h-pyrazole-3-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 1-[4-(1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate (CAS 1710661-64-5) is a chemical compound with the molecular formula C13H10N4O3 and a molecular weight of 270.24 g/mol. IUPAC name: methyl 1-[4-(1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate. InChIKey: QXLHYULORHEOPO-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O3 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | methyl 1-[4-(1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate |
| InChIKey | QXLHYULORHEOPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C=C1)C2=CC=C(C=C2)C3=NOC=N3 |
Computed by PubChem (NCBI)