Products 123990-50-1
CAS 123990-50-1 is the registry number for 2-Chloro-7,7-dimethyl-5H,7H,8H-pyrano(4,3-b)pyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile (CAS 123990-50-1) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile. InChIKey: KBRLGRJHWGRBJC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile |
| InChIKey | KBRLGRJHWGRBJC-UHFFFAOYSA-N |
| SMILES | CC1(CC2=NC(=C(C=C2CO1)C#N)Cl)C |
Computed by PubChem (NCBI)