CAS 1240526-31-1 is the registry number for 5-(1-Benzofuran-2-yl)-2H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(1-benzofuran-2-yl)-2H-tetrazole (CAS 1240526-31-1) is a chemical compound with the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. IUPAC name: 5-(1-benzofuran-2-yl)-2H-tetrazole. InChIKey: VAHCWUJHXCNFMS-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 5-(1-benzofuran-2-yl)-2H-tetrazole |
| InChIKey | VAHCWUJHXCNFMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NNN=N3 |
Computed by PubChem (NCBI)