CAS 304869-93-0 is the registry number for 8-Methyl-[1,2,5]oxadiazolo[3,4-f]cinnoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-[1,2,5]oxadiazolo[3,4-f]cinnoline (CAS 304869-93-0) is a chemical compound with the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. IUPAC name: 8-methyl-[1,2,5]oxadiazolo[3,4-f]cinnoline. InChIKey: BPXOLPGZIZVZCT-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 8-methyl-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| InChIKey | BPXOLPGZIZVZCT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC3=NON=C32)N=N1 |
Computed by PubChem (NCBI)