CAS 148191-54-2 is the registry number for Pyrazolo[1,5-a]pyrido[3,4-e]pyrimidin-6(7h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (CAS 148191-54-2) is a chemical compound with the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. IUPAC name: 2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one. InChIKey: UZIKPIHZEPEKNM-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| InChIKey | UZIKPIHZEPEKNM-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1N3C(=CC=N3)N=C2 |
Computed by PubChem (NCBI)