CAS 1240526-79-7 appears in our catalog under these names: 1,4-Difluoro-2-trifluoromethanesulfonylbenzene, 95%, 1,4-Difluoro-2-trifluoromethanesulfonylbenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1,4-difluoro-2-(trifluoromethylsulfonyl)benzene (CAS 1240526-79-7) is a chemical compound with the molecular formula C7H3F5O2S and a molecular weight of 246.16 g/mol. IUPAC name: 1,4-difluoro-2-(trifluoromethylsulfonyl)benzene. InChIKey: TZGUTGNHMZPRDW-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O2S |
|---|---|
| Molecular weight | 246.16 g/mol |
| IUPAC name | 1,4-difluoro-2-(trifluoromethylsulfonyl)benzene |
| InChIKey | TZGUTGNHMZPRDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)