Products 220227-89-4
CAS 220227-89-4 is the registry number for 2-Fluoro-5-(trifluoromethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-5-(trifluoromethyl)benzenesulfonyl fluoride (CAS 220227-89-4) is a chemical compound with the molecular formula C7H3F5O2S and a molecular weight of 246.16 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)benzenesulfonyl fluoride. InChIKey: VKBPNUODPPOMTL-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O2S |
|---|---|
| Molecular weight | 246.16 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)benzenesulfonyl fluoride |
| InChIKey | VKBPNUODPPOMTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S(=O)(=O)F)F |
Computed by PubChem (NCBI)