CAS 651-85-4 is the registry number for 1,2,3,4,5-Pentafluoro-6-(methylsulfonyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentafluoro-6-methylsulfonylbenzene (CAS 651-85-4) is a chemical compound with the molecular formula C7H3F5O2S and a molecular weight of 246.16 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-methylsulfonylbenzene. InChIKey: WFYROSQTNAJIIF-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O2S |
|---|---|
| Molecular weight | 246.16 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-methylsulfonylbenzene |
| InChIKey | WFYROSQTNAJIIF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)