CAS 1240527-13-2 is the registry number for (5-Methyl-(1,3,4)oxadiazol-2-yl)-acetic acid potassium salt. Offered by: Biosynth. Available pack sizes: 0,25g, 0,5g, 1g, 2g, 5g.
Potassium 2-(5-methyl-1,3,4-oxadiazol-2-yl)acetate (CAS 1240527-13-2) is a chemical compound with the molecular formula C5H5KN2O3 and a molecular weight of 180.20 g/mol. IUPAC name: potassium 2-(5-methyl-1,3,4-oxadiazol-2-yl)acetate. InChIKey: DLAFLGPADXWOCO-UHFFFAOYSA-M.
| Molecular formula | C5H5KN2O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | potassium 2-(5-methyl-1,3,4-oxadiazol-2-yl)acetate |
| InChIKey | DLAFLGPADXWOCO-UHFFFAOYSA-M |
| SMILES | CC1=NN=C(O1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)