CAS 158014-03-0 appears in our catalog under these names: 2-Cyano-2-(hydroxyimino)acetic acid ethyl ester, potassium salt, 98%, Ethyl Cyanoglyxylate-2-oxyme Potassium Salt, >95% (HPLC), 2–Cyano–2–(hydroxyimino)acetic Acid Ethyl Ester Potassium Salt, Ethyl cyanoglyxylate-2-oxyme potassium salt, 2-Cyano-2-(hydroxyimino)acetic acid ethyl ester, potassium salt 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 50g, 500g, 250g.
Potassium ethyl (2E)-2-cyano-2-oxidoiminoacetate (CAS 158014-03-0) is a chemical compound with the molecular formula C5H5KN2O3 and a molecular weight of 180.20 g/mol. IUPAC name: potassium ethyl (2E)-2-cyano-2-oxidoiminoacetate. InChIKey: ZFBMUWGNRJITLS-KQGICBIGSA-M.
| Molecular formula | C5H5KN2O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | potassium ethyl (2E)-2-cyano-2-oxidoiminoacetate |
| InChIKey | ZFBMUWGNRJITLS-KQGICBIGSA-M |
| SMILES | CCOC(=O)/C(=N/[O-])/C#N.[K+] |
Computed by PubChem (NCBI)