CAS 1993194-60-7 is the registry number for Potassium 3-ethyl-1,2,4-oxadiazole-5-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium 3-ethyl-1,2,4-oxadiazole-5-carboxylate (CAS 1993194-60-7) is a chemical compound with the molecular formula C5H5KN2O3 and a molecular weight of 180.20 g/mol. IUPAC name: potassium 3-ethyl-1,2,4-oxadiazole-5-carboxylate. InChIKey: POOMHGNOJRYOJW-UHFFFAOYSA-M.
| Molecular formula | C5H5KN2O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | potassium 3-ethyl-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | POOMHGNOJRYOJW-UHFFFAOYSA-M |
| SMILES | CCC1=NOC(=N1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)