CAS 1240527-25-6 appears in our catalog under these names: 1-Methylindolin-5-amine dihydrochloride, 96%, 96%, 1-Methyl-2,3-dihydro-1h-indol-5-amine Dihydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
1-methyl-2,3-dihydroindol-5-amine;dihydrochloride (CAS 1240527-25-6) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 1-methyl-2,3-dihydroindol-5-amine;dihydrochloride. InChIKey: JPOXHCBFVAKBSR-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 1-methyl-2,3-dihydroindol-5-amine;dihydrochloride |
| InChIKey | JPOXHCBFVAKBSR-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)