CAS 1240529-37-6 appears in our catalog under these names: 2-Methyl-2-((5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy)propanoic acid, 95%, 2-Methyl-2-((5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-methyl-2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoic acid (CAS 1240529-37-6) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 2-methyl-2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoic acid. InChIKey: REFIHKNRUBIIKC-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 2-methyl-2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoic acid |
| InChIKey | REFIHKNRUBIIKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC2=C(C=C1)C(=O)CCC2 |
Computed by PubChem (NCBI)