CAS 1240529-61-6 appears in our catalog under these names: N-(Thiophen-3-ylmethyl)aniline hydrochloride, 95%, N-((Thiophen-3-yl)methyl)aniline hydrochloride, 95%, N-(Thiophen-3-ylmethyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-(thiophen-3-ylmethyl)aniline;hydrochloride (CAS 1240529-61-6) is a chemical compound with the molecular formula C11H12ClNS and a molecular weight of 225.74 g/mol. IUPAC name: N-(thiophen-3-ylmethyl)aniline;hydrochloride. InChIKey: CREYUAYVZZJHNC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNS |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | N-(thiophen-3-ylmethyl)aniline;hydrochloride |
| InChIKey | CREYUAYVZZJHNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=CSC=C2.Cl |
Computed by PubChem (NCBI)