CAS 4209-18-1 appears in our catalog under these names: 3-Benzyl-4-methylthiazolium chloride, 98%, 3-Benzyl-4-methylthiazolium Chloride, >98.0%(HPLC)(T), 3-Benzyl-4-methylthiazol-3-ium chloride 95+%, 3-Benzyl-4-methylthiazol-3-ium chloride, 98%, 98%, 3-Benzyl-4-methylthiazol-3-ium chloride, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 100g, 5g, 250mg.
3-benzyl-4-methyl-1,3-thiazol-3-ium chloride (CAS 4209-18-1) is a chemical compound with the molecular formula C11H12ClNS and a molecular weight of 225.74 g/mol. IUPAC name: 3-benzyl-4-methyl-1,3-thiazol-3-ium chloride. InChIKey: ZGBNEPNQIDHABT-UHFFFAOYSA-M.
| Molecular formula | C11H12ClNS |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | 3-benzyl-4-methyl-1,3-thiazol-3-ium chloride |
| InChIKey | ZGBNEPNQIDHABT-UHFFFAOYSA-M |
| SMILES | CC1=CSC=[N+]1CC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)