CAS 863991-95-1 is the registry number for 1-(2-Thien-2-ylphenyl)methanamine hydrochloride, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
(2-thiophen-2-ylphenyl)methanamine;hydrochloride (CAS 863991-95-1) is a chemical compound with the molecular formula C11H12ClNS and a molecular weight of 225.74 g/mol. IUPAC name: (2-thiophen-2-ylphenyl)methanamine;hydrochloride. InChIKey: XLJIHGHEJAGJJC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNS |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | (2-thiophen-2-ylphenyl)methanamine;hydrochloride |
| InChIKey | XLJIHGHEJAGJJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)