CAS 1240554-98-6 is the registry number for ((1R,3S)-1-Amino-3-(4-bromophenyl)cyclopentyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,3S)-1-amino-3-(4-bromophenyl)cyclopentyl]methanol (CAS 1240554-98-6) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: [(1R,3S)-1-amino-3-(4-bromophenyl)cyclopentyl]methanol. InChIKey: MKDOHHWCOHETDN-CMPLNLGQSA-N.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | [(1R,3S)-1-amino-3-(4-bromophenyl)cyclopentyl]methanol |
| InChIKey | MKDOHHWCOHETDN-CMPLNLGQSA-N |
| SMILES | C1C[C@@](C[C@H]1C2=CC=C(C=C2)Br)(CO)N |
Computed by PubChem (NCBI)