CAS 1240573-73-2 appears in our catalog under these names: 1-(3-Methylbutyl)-4-nitro-1h-pyrazole, 95%, 1–Isopentyl–4–nitro–1H–pyrazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(3-methylbutyl)-4-nitropyrazole (CAS 1240573-73-2) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 1-(3-methylbutyl)-4-nitropyrazole. InChIKey: YVXROGVHFOYTNG-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 1-(3-methylbutyl)-4-nitropyrazole |
| InChIKey | YVXROGVHFOYTNG-UHFFFAOYSA-N |
| SMILES | CC(C)CCN1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)