CAS 1240583-15-6 appears in our catalog under these names: (2R,3R)-2,3-Dimethyl-1-piperazinecarboxylic Acid 1,1-Dimethylethyl Ester, (2R,3R)-tert-Butyl 2,3-dimethylpiperazine-1-carboxylate, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 25mg, 50mg.
Tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate (CAS 1240583-15-6) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate. InChIKey: RMTXPZPWCLGBFD-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate |
| InChIKey | RMTXPZPWCLGBFD-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@H](N(CCN1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)