CAS 2702250-54-0 is the registry number for rel-tert-Butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate (CAS 2702250-54-0) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate. InChIKey: RMTXPZPWCLGBFD-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,3R)-2,3-dimethylpiperazine-1-carboxylate |
| InChIKey | RMTXPZPWCLGBFD-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@H](N(CCN1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)