CAS 1240596-19-3 appears in our catalog under these names: Methyl 3-bromo-4-methylpicolinate 98%, Methyl 3-bromo-4-methylpicolinate, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-bromo-4-methylpyridine-2-carboxylate (CAS 1240596-19-3) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 3-bromo-4-methylpyridine-2-carboxylate. InChIKey: BGUKNUUIAIMPLP-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 3-bromo-4-methylpyridine-2-carboxylate |
| InChIKey | BGUKNUUIAIMPLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)