CAS 1240598-90-6 is the registry number for Ethyl 4-phenyl-2-thioxo-1,2-dihydropyrimidine-5-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate (CAS 1240598-90-6) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: ethyl 6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate. InChIKey: GVOKOZFJKLGVFE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | ethyl 6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carboxylate |
| InChIKey | GVOKOZFJKLGVFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=S)N=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)