CAS 679414-38-1 is the registry number for 3-(((4-Methylpyrimidin-2-yl)thio)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]benzoic acid (CAS 679414-38-1) is a chemical compound with the molecular formula C13H12N2O2S and a molecular weight of 260.31 g/mol. IUPAC name: 3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]benzoic acid. InChIKey: VURXFXRVBVKXIE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 3-[(4-methylpyrimidin-2-yl)sulfanylmethyl]benzoic acid |
| InChIKey | VURXFXRVBVKXIE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1)SCC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)